About decanedioate dichloride
decanedioate dichloride (PubChem CID 21256251) has the molecular formula C10H16Cl2O4-4
and a molecular weight of 271.14 g/mol. Its IUPAC name is decanedioate dichloride.
Molecular Properties
| Compound Name | decanedioate dichloride |
| PubChem CID | 21256251 |
| Molecular Formula | C10H16Cl2O4-4 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | decanedioate dichloride |
| SMILES | O=C([O-])CCCCCCCCC(=O)[O-].[Cl-].[Cl-] |
| InChI | InChI=1S/C10H18O4.2ClH/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;/h1-8H2,(H,11,12)(H,13,14);2*1H/p-4 |
| InChIKey | DDHPBAGICYAAKM-UHFFFAOYSA-J |
| XLogP | -6.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanedioate dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanedioate dichloride?
The IUPAC name of decanedioate dichloride (CID 21256251) is decanedioate dichloride.
What is the SMILES notation for decanedioate dichloride?
The canonical SMILES for decanedioate dichloride is O=C([O-])CCCCCCCCC(=O)[O-].[Cl-].[Cl-].
What is the InChIKey of decanedioate dichloride?
The InChIKey is DDHPBAGICYAAKM-UHFFFAOYSA-J. The full InChI is InChI=1S/C10H18O4.2ClH/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;/h1-8H2,(H,11,12)(H,13,14);2*1H/p-4.
What are the key properties of decanedioate dichloride?
decanedioate dichloride has a molecular weight of 271.14 g/mol, XLogP of -6.39, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decanedioate dichloride is sourced from PubChem (CID 21256251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).