About calcium decanedioate
calcium decanedioate (PubChem CID 11637296) has the molecular formula C10H16CaO4
and a molecular weight of 240.31 g/mol. Its IUPAC name is calcium decanedioate.
Molecular Properties
| Compound Name | calcium decanedioate |
| PubChem CID | 11637296 |
| Molecular Formula | C10H16CaO4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | calcium decanedioate |
| SMILES | O=C([O-])CCCCCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C10H18O4.Ca/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;/h1-8H2,(H,11,12)(H,13,14);/q;+2/p-2 |
| InChIKey | OKFNSRHNCAUVOQ-UHFFFAOYSA-L |
| XLogP | -0.77 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium decanedioate?
The IUPAC name of calcium decanedioate (CID 11637296) is calcium decanedioate.
What is the SMILES notation for calcium decanedioate?
The canonical SMILES for calcium decanedioate is O=C([O-])CCCCCCCCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium decanedioate?
The InChIKey is OKFNSRHNCAUVOQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H18O4.Ca/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;/h1-8H2,(H,11,12)(H,13,14);/q;+2/p-2.
What are the key properties of calcium decanedioate?
calcium decanedioate has a molecular weight of 240.31 g/mol, XLogP of -0.77, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium decanedioate is sourced from PubChem (CID 11637296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).