About cadmium(2+);pentanedioate
cadmium(2+);pentanedioate (PubChem CID 19376914) has the molecular formula C5H6CdO4
and a molecular weight of 242.51 g/mol. Its IUPAC name is cadmium(2+);pentanedioate.
Molecular Properties
| Compound Name | cadmium(2+);pentanedioate |
| PubChem CID | 19376914 |
| Molecular Formula | C5H6CdO4 |
| Molecular Weight | 242.51 g/mol |
| Exact Mass | 243.93 |
| IUPAC Name | cadmium(2+);pentanedioate |
| SMILES | O=C([O-])CCCC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/C5H8O4.Cd/c6-4(7)2-1-3-5(8)9;/h1-3H2,(H,6,7)(H,8,9);/q;+2/p-2 |
| InChIKey | ZHALGQWYJAGFHI-UHFFFAOYSA-L |
| XLogP | -2.35 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.51 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium(2+);pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);pentanedioate?
The IUPAC name of cadmium(2+);pentanedioate (CID 19376914) is cadmium(2+);pentanedioate.
What is the SMILES notation for cadmium(2+);pentanedioate?
The canonical SMILES for cadmium(2+);pentanedioate is O=C([O-])CCCC(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);pentanedioate?
The InChIKey is ZHALGQWYJAGFHI-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O4.Cd/c6-4(7)2-1-3-5(8)9;/h1-3H2,(H,6,7)(H,8,9);/q;+2/p-2.
What are the key properties of cadmium(2+);pentanedioate?
cadmium(2+);pentanedioate has a molecular weight of 242.51 g/mol, XLogP of -2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);pentanedioate is sourced from PubChem (CID 19376914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).