About disodium;pentanedioate;hydrochloride
disodium;pentanedioate;hydrochloride (PubChem CID 175525255) has the molecular formula C5H7ClNa2O4
and a molecular weight of 212.54 g/mol. Its IUPAC name is disodium;pentanedioate;hydrochloride.
Molecular Properties
| Compound Name | disodium;pentanedioate;hydrochloride |
| PubChem CID | 175525255 |
| Molecular Formula | C5H7ClNa2O4 |
| Molecular Weight | 212.54 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | disodium;pentanedioate;hydrochloride |
| SMILES | Cl.O=C([O-])CCCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H8O4.ClH.2Na/c6-4(7)2-1-3-5(8)9;;;/h1-3H2,(H,6,7)(H,8,9);1H;;/q;;2*+1/p-2 |
| InChIKey | QAYRTYVDZQEUMQ-UHFFFAOYSA-L |
| XLogP | -7.91 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.54 |
| LogP ≤ 5 | -7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;pentanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;pentanedioate;hydrochloride?
The IUPAC name of disodium;pentanedioate;hydrochloride (CID 175525255) is disodium;pentanedioate;hydrochloride.
What is the SMILES notation for disodium;pentanedioate;hydrochloride?
The canonical SMILES for disodium;pentanedioate;hydrochloride is Cl.O=C([O-])CCCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;pentanedioate;hydrochloride?
The InChIKey is QAYRTYVDZQEUMQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O4.ClH.2Na/c6-4(7)2-1-3-5(8)9;;;/h1-3H2,(H,6,7)(H,8,9);1H;;/q;;2*+1/p-2.
What are the key properties of disodium;pentanedioate;hydrochloride?
disodium;pentanedioate;hydrochloride has a molecular weight of 212.54 g/mol, XLogP of -7.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;pentanedioate;hydrochloride is sourced from PubChem (CID 175525255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).