C4H7NaO3 — CID 139025091
sodium 4-hydroxy(1,2,3,4-13C4)butanoate (PubChem CID 139025091) has the molecular formula C4H7NaO3 and a molecular weight of 130.06 g/mol. Its IUPAC name is sodium 4-hydroxy(1,2,3,4-13C4)butanoate.
| Compound Name | sodium 4-hydroxy(1,2,3,4-13C4)butanoate |
|---|---|
| PubChem CID | 139025091 |
| Molecular Formula | C4H7NaO3 |
| Molecular Weight | 130.06 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | sodium 4-hydroxy(1,2,3,4-13C4)butanoate |
| SMILES | O=[13C]([O-])[13CH2][13CH2][13CH2]O.[Na+] |
| InChI | InChI=1S/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1/i1+1,2+1,3+1,4+1; |
| InChIKey | XYGBKMMCQDZQOZ-UJNKEPEOSA-M |
| XLogP | -4.49 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.06 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |