About sodium;dodecan-1-ol;octadecanoate
sodium;dodecan-1-ol;octadecanoate (PubChem CID 174506535) has the molecular formula C30H61NaO3
and a molecular weight of 492.81 g/mol. Its IUPAC name is sodium;dodecan-1-ol;octadecanoate.
Molecular Properties
| Compound Name | sodium;dodecan-1-ol;octadecanoate |
| PubChem CID | 174506535 |
| Molecular Formula | C30H61NaO3 |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 492.45 |
| IUPAC Name | sodium;dodecan-1-ol;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCO.[Na+] |
| InChI | InChI=1S/C18H36O2.C12H26O.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13;/h2-17H2,1H3,(H,19,20);13H,2-12H2,1H3;/q;;+1/p-1 |
| InChIKey | WYALHDQGCTWTPW-UHFFFAOYSA-M |
| XLogP | 5.90 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecan-1-ol;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecan-1-ol;octadecanoate?
The IUPAC name of sodium;dodecan-1-ol;octadecanoate (CID 174506535) is sodium;dodecan-1-ol;octadecanoate.
What is the SMILES notation for sodium;dodecan-1-ol;octadecanoate?
The canonical SMILES for sodium;dodecan-1-ol;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCO.[Na+].
What is the InChIKey of sodium;dodecan-1-ol;octadecanoate?
The InChIKey is WYALHDQGCTWTPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.C12H26O.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13;/h2-17H2,1H3,(H,19,20);13H,2-12H2,1H3;/q;;+1/p-1.
What are the key properties of sodium;dodecan-1-ol;octadecanoate?
sodium;dodecan-1-ol;octadecanoate has a molecular weight of 492.81 g/mol, XLogP of 5.90, 26 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecan-1-ol;octadecanoate is sourced from PubChem (CID 174506535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).