C14H29NaO4 — CID 23720166
sodium;dodecanoate;ethane-1,2-diol (PubChem CID 23720166) has the molecular formula C14H29NaO4 and a molecular weight of 284.37 g/mol. Its IUPAC name is sodium;dodecanoate;ethane-1,2-diol.
| Compound Name | sodium;dodecanoate;ethane-1,2-diol |
|---|---|
| PubChem CID | 23720166 |
| Molecular Formula | C14H29NaO4 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | sodium;dodecanoate;ethane-1,2-diol |
| SMILES | CCCCCCCCCCCC(=O)[O-].OCCO.[Na+] |
| InChI | InChI=1S/C12H24O2.C2H6O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;3-1-2-4;/h2-11H2,1H3,(H,13,14);3-4H,1-2H2;/q;;+1/p-1 |
| InChIKey | LWHVCHAUACZFOE-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|