About magnesium bis(6-hydroxyhexanoate)
magnesium bis(6-hydroxyhexanoate) (PubChem CID 156828255) has the molecular formula C12H22MgO6
and a molecular weight of 286.61 g/mol. Its IUPAC name is magnesium bis(6-hydroxyhexanoate).
Molecular Properties
| Compound Name | magnesium bis(6-hydroxyhexanoate) |
| PubChem CID | 156828255 |
| Molecular Formula | C12H22MgO6 |
| Molecular Weight | 286.61 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | magnesium bis(6-hydroxyhexanoate) |
| SMILES | O=C([O-])CCCCCO.O=C([O-])CCCCCO.[Mg+2] |
| InChI | InChI=1S/2C6H12O3.Mg/c2*7-5-3-1-2-4-6(8)9;/h2*7H,1-5H2,(H,8,9);/q;;+2/p-2 |
| InChIKey | YTCGJLNHVYYARD-UHFFFAOYSA-L |
| XLogP | -1.80 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.61 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(6-hydroxyhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(6-hydroxyhexanoate)?
The IUPAC name of magnesium bis(6-hydroxyhexanoate) (CID 156828255) is magnesium bis(6-hydroxyhexanoate).
What is the SMILES notation for magnesium bis(6-hydroxyhexanoate)?
The canonical SMILES for magnesium bis(6-hydroxyhexanoate) is O=C([O-])CCCCCO.O=C([O-])CCCCCO.[Mg+2].
What is the InChIKey of magnesium bis(6-hydroxyhexanoate)?
The InChIKey is YTCGJLNHVYYARD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H12O3.Mg/c2*7-5-3-1-2-4-6(8)9;/h2*7H,1-5H2,(H,8,9);/q;;+2/p-2.
What are the key properties of magnesium bis(6-hydroxyhexanoate)?
magnesium bis(6-hydroxyhexanoate) has a molecular weight of 286.61 g/mol, XLogP of -1.80, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(6-hydroxyhexanoate) is sourced from PubChem (CID 156828255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).