About 7-hydroxyoctanoate
7-hydroxyoctanoate (PubChem CID 20848985) has the molecular formula C8H15O3-
and a molecular weight of 159.20 g/mol. Its IUPAC name is 7-hydroxyoctanoate.
Molecular Properties
| Compound Name | 7-hydroxyoctanoate |
| PubChem CID | 20848985 |
| Molecular Formula | C8H15O3- |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 7-hydroxyoctanoate |
| SMILES | CC(O)CCCCCC(=O)[O-] |
| InChI | InChI=1S/C8H16O3/c1-7(9)5-3-2-4-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)/p-1 |
| InChIKey | OFCMTSZRXXFMBQ-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyoctanoate?
The IUPAC name of 7-hydroxyoctanoate (CID 20848985) is 7-hydroxyoctanoate.
What is the SMILES notation for 7-hydroxyoctanoate?
The canonical SMILES for 7-hydroxyoctanoate is CC(O)CCCCCC(=O)[O-].
What is the InChIKey of 7-hydroxyoctanoate?
The InChIKey is OFCMTSZRXXFMBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O3/c1-7(9)5-3-2-4-6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)/p-1.
What are the key properties of 7-hydroxyoctanoate?
7-hydroxyoctanoate has a molecular weight of 159.20 g/mol, XLogP of 0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyoctanoate is sourced from PubChem (CID 20848985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).