About (5R)-5-hydroxyhexanoate
(5R)-5-hydroxyhexanoate (PubChem CID 7131042) has the molecular formula C6H11O3-
and a molecular weight of 131.15 g/mol. Its IUPAC name is (5R)-5-hydroxyhexanoate.
Molecular Properties
| Compound Name | (5R)-5-hydroxyhexanoate |
| PubChem CID | 7131042 |
| Molecular Formula | C6H11O3- |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (5R)-5-hydroxyhexanoate |
| SMILES | C[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1/t5-/m1/s1 |
| InChIKey | YDCRNMJQROAWFT-RXMQYKEDSA-M |
| XLogP | -0.71 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-5-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-hydroxyhexanoate?
The IUPAC name of (5R)-5-hydroxyhexanoate (CID 7131042) is (5R)-5-hydroxyhexanoate.
What is the SMILES notation for (5R)-5-hydroxyhexanoate?
The canonical SMILES for (5R)-5-hydroxyhexanoate is C[C@@H](O)CCCC(=O)[O-].
What is the InChIKey of (5R)-5-hydroxyhexanoate?
The InChIKey is YDCRNMJQROAWFT-RXMQYKEDSA-M. The full InChI is InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1/t5-/m1/s1.
What are the key properties of (5R)-5-hydroxyhexanoate?
(5R)-5-hydroxyhexanoate has a molecular weight of 131.15 g/mol, XLogP of -0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-hydroxyhexanoate is sourced from PubChem (CID 7131042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).