About potassium 5-hydroxyheptanoate
potassium 5-hydroxyheptanoate (PubChem CID 23698795) has the molecular formula C7H13KO3
and a molecular weight of 184.28 g/mol. Its IUPAC name is potassium 5-hydroxyheptanoate.
Molecular Properties
| Compound Name | potassium 5-hydroxyheptanoate |
| PubChem CID | 23698795 |
| Molecular Formula | C7H13KO3 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | potassium 5-hydroxyheptanoate |
| SMILES | CCC(O)CCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C7H14O3.K/c1-2-6(8)4-3-5-7(9)10;/h6,8H,2-5H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | KHFFSBFZEDPRLL-UHFFFAOYSA-M |
| XLogP | -3.32 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 5-hydroxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-hydroxyheptanoate?
The IUPAC name of potassium 5-hydroxyheptanoate (CID 23698795) is potassium 5-hydroxyheptanoate.
What is the SMILES notation for potassium 5-hydroxyheptanoate?
The canonical SMILES for potassium 5-hydroxyheptanoate is CCC(O)CCCC(=O)[O-].[K+].
What is the InChIKey of potassium 5-hydroxyheptanoate?
The InChIKey is KHFFSBFZEDPRLL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O3.K/c1-2-6(8)4-3-5-7(9)10;/h6,8H,2-5H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of potassium 5-hydroxyheptanoate?
potassium 5-hydroxyheptanoate has a molecular weight of 184.28 g/mol, XLogP of -3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-hydroxyheptanoate is sourced from PubChem (CID 23698795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).