About (5R)-5-hydroxyheptanoic acid
(5R)-5-hydroxyheptanoic acid (PubChem CID 14029725) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is (5R)-5-hydroxyheptanoic acid.
Molecular Properties
| Compound Name | (5R)-5-hydroxyheptanoic acid |
| PubChem CID | 14029725 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (5R)-5-hydroxyheptanoic acid |
| SMILES | CC[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C7H14O3/c1-2-6(8)4-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | ICKVZOWXZYBERI-ZCFIWIBFSA-N |
| XLogP | 1.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-hydroxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-hydroxyheptanoic acid?
The IUPAC name of (5R)-5-hydroxyheptanoic acid (CID 14029725) is (5R)-5-hydroxyheptanoic acid.
What is the SMILES notation for (5R)-5-hydroxyheptanoic acid?
The canonical SMILES for (5R)-5-hydroxyheptanoic acid is CC[C@@H](O)CCCC(=O)O.
What is the InChIKey of (5R)-5-hydroxyheptanoic acid?
The InChIKey is ICKVZOWXZYBERI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14O3/c1-2-6(8)4-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1.
What are the key properties of (5R)-5-hydroxyheptanoic acid?
(5R)-5-hydroxyheptanoic acid has a molecular weight of 146.19 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-hydroxyheptanoic acid is sourced from PubChem (CID 14029725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).