(5R)-5-hydroxyheptanoic acid

C7H14O3 — CID 14029725

IUPAC(5R)-5-hydroxyheptanoic acid
SMILESCC[C@@H](O)CCCC(=O)O
InChIInChI=1S/C7H14O3/c1-2-6(8)4-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1
InChIKeyICKVZOWXZYBERI-ZCFIWIBFSA-N
MW146.19 g/mol
LogP1.01
Rot. Bonds5

About (5R)-5-hydroxyheptanoic acid

(5R)-5-hydroxyheptanoic acid (PubChem CID 14029725) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (5R)-5-hydroxyheptanoic acid.

Molecular Properties

Compound Name(5R)-5-hydroxyheptanoic acid
PubChem CID14029725
Molecular FormulaC7H14O3
Molecular Weight146.19 g/mol
Exact Mass146.09
IUPAC Name(5R)-5-hydroxyheptanoic acid
SMILESCC[C@@H](O)CCCC(=O)O
InChIInChI=1S/C7H14O3/c1-2-6(8)4-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1
InChIKeyICKVZOWXZYBERI-ZCFIWIBFSA-N
XLogP1.01
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 51.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (5R)-5-hydroxyheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5R)-5-hydroxyheptanoic acid?
The IUPAC name of (5R)-5-hydroxyheptanoic acid (CID 14029725) is (5R)-5-hydroxyheptanoic acid.
What is the SMILES notation for (5R)-5-hydroxyheptanoic acid?
The canonical SMILES for (5R)-5-hydroxyheptanoic acid is CC[C@@H](O)CCCC(=O)O.
What is the InChIKey of (5R)-5-hydroxyheptanoic acid?
The InChIKey is ICKVZOWXZYBERI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H14O3/c1-2-6(8)4-3-5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m1/s1.
What are the key properties of (5R)-5-hydroxyheptanoic acid?
(5R)-5-hydroxyheptanoic acid has a molecular weight of 146.19 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-hydroxyheptanoic acid is sourced from PubChem (CID 14029725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).