About 5-hydroxytridecanedioic acid
5-hydroxytridecanedioic acid (PubChem CID 139805426) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is 5-hydroxytridecanedioic acid.
Molecular Properties
| Compound Name | 5-hydroxytridecanedioic acid |
| PubChem CID | 139805426 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5-hydroxytridecanedioic acid |
| SMILES | O=C(O)CCCCCCCC(O)CCCC(=O)O |
| InChI | InChI=1S/C13H24O5/c14-11(8-6-10-13(17)18)7-4-2-1-3-5-9-12(15)16/h11,14H,1-10H2,(H,15,16)(H,17,18) |
| InChIKey | IZZLYZKNDSWCGA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxytridecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxytridecanedioic acid?
The IUPAC name of 5-hydroxytridecanedioic acid (CID 139805426) is 5-hydroxytridecanedioic acid.
What is the SMILES notation for 5-hydroxytridecanedioic acid?
The canonical SMILES for 5-hydroxytridecanedioic acid is O=C(O)CCCCCCCC(O)CCCC(=O)O.
What is the InChIKey of 5-hydroxytridecanedioic acid?
The InChIKey is IZZLYZKNDSWCGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5/c14-11(8-6-10-13(17)18)7-4-2-1-3-5-9-12(15)16/h11,14H,1-10H2,(H,15,16)(H,17,18).
What are the key properties of 5-hydroxytridecanedioic acid?
5-hydroxytridecanedioic acid has a molecular weight of 260.33 g/mol, XLogP of 2.42, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxytridecanedioic acid is sourced from PubChem (CID 139805426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).