About potassium 5-hydroxyhexadecanoate
potassium 5-hydroxyhexadecanoate (PubChem CID 171774657) has the molecular formula C16H31KO3
and a molecular weight of 310.52 g/mol. Its IUPAC name is potassium 5-hydroxyhexadecanoate.
Molecular Properties
| Compound Name | potassium 5-hydroxyhexadecanoate |
| PubChem CID | 171774657 |
| Molecular Formula | C16H31KO3 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | potassium 5-hydroxyhexadecanoate |
| SMILES | CCCCCCCCCCCC(O)CCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C16H32O3.K/c1-2-3-4-5-6-7-8-9-10-12-15(17)13-11-14-16(18)19;/h15,17H,2-14H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | AMAJCLCJUXQPEQ-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-hydroxyhexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-hydroxyhexadecanoate?
The IUPAC name of potassium 5-hydroxyhexadecanoate (CID 171774657) is potassium 5-hydroxyhexadecanoate.
What is the SMILES notation for potassium 5-hydroxyhexadecanoate?
The canonical SMILES for potassium 5-hydroxyhexadecanoate is CCCCCCCCCCCC(O)CCCC(=O)[O-].[K+].
What is the InChIKey of potassium 5-hydroxyhexadecanoate?
The InChIKey is AMAJCLCJUXQPEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H32O3.K/c1-2-3-4-5-6-7-8-9-10-12-15(17)13-11-14-16(18)19;/h15,17H,2-14H2,1H3,(H,18,19);/q;+1/p-1.
What are the key properties of potassium 5-hydroxyhexadecanoate?
potassium 5-hydroxyhexadecanoate has a molecular weight of 310.52 g/mol, XLogP of 0.19, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-hydroxyhexadecanoate is sourced from PubChem (CID 171774657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).