About potassium 3-hydroxydodecanoate
potassium 3-hydroxydodecanoate (PubChem CID 171061524) has the molecular formula C12H23KO3
and a molecular weight of 254.41 g/mol. Its IUPAC name is potassium 3-hydroxydodecanoate.
Molecular Properties
| Compound Name | potassium 3-hydroxydodecanoate |
| PubChem CID | 171061524 |
| Molecular Formula | C12H23KO3 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | potassium 3-hydroxydodecanoate |
| SMILES | CCCCCCCCCC(O)CC(=O)[O-].[K+] |
| InChI | InChI=1S/C12H24O3.K/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15;/h11,13H,2-10H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | ZOSDUXZPAMLNNY-UHFFFAOYSA-M |
| XLogP | -1.37 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-hydroxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-hydroxydodecanoate?
The IUPAC name of potassium 3-hydroxydodecanoate (CID 171061524) is potassium 3-hydroxydodecanoate.
What is the SMILES notation for potassium 3-hydroxydodecanoate?
The canonical SMILES for potassium 3-hydroxydodecanoate is CCCCCCCCCC(O)CC(=O)[O-].[K+].
What is the InChIKey of potassium 3-hydroxydodecanoate?
The InChIKey is ZOSDUXZPAMLNNY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O3.K/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15;/h11,13H,2-10H2,1H3,(H,14,15);/q;+1/p-1.
What are the key properties of potassium 3-hydroxydodecanoate?
potassium 3-hydroxydodecanoate has a molecular weight of 254.41 g/mol, XLogP of -1.37, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-hydroxydodecanoate is sourced from PubChem (CID 171061524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).