About 3-hydroxydecanedioate
3-hydroxydecanedioate (PubChem CID 20848938) has the molecular formula C10H16O5-2
and a molecular weight of 216.23 g/mol. Its IUPAC name is 3-hydroxydecanedioate.
Molecular Properties
| Compound Name | 3-hydroxydecanedioate |
| PubChem CID | 20848938 |
| Molecular Formula | C10H16O5-2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-hydroxydecanedioate |
| SMILES | O=C([O-])CCCCCCC(O)CC(=O)[O-] |
| InChI | InChI=1S/C10H18O5/c11-8(7-10(14)15)5-3-1-2-4-6-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15)/p-2 |
| InChIKey | OQYZCCKCJQWHIE-UHFFFAOYSA-L |
| XLogP | -1.42 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxydecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxydecanedioate?
The IUPAC name of 3-hydroxydecanedioate (CID 20848938) is 3-hydroxydecanedioate.
What is the SMILES notation for 3-hydroxydecanedioate?
The canonical SMILES for 3-hydroxydecanedioate is O=C([O-])CCCCCCC(O)CC(=O)[O-].
What is the InChIKey of 3-hydroxydecanedioate?
The InChIKey is OQYZCCKCJQWHIE-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H18O5/c11-8(7-10(14)15)5-3-1-2-4-6-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15)/p-2.
What are the key properties of 3-hydroxydecanedioate?
3-hydroxydecanedioate has a molecular weight of 216.23 g/mol, XLogP of -1.42, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxydecanedioate is sourced from PubChem (CID 20848938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).