About 8-hydroxydodecanoate
8-hydroxydodecanoate (PubChem CID 155802527) has the molecular formula C12H23O3-
and a molecular weight of 215.31 g/mol. Its IUPAC name is 8-hydroxydodecanoate.
Molecular Properties
| Compound Name | 8-hydroxydodecanoate |
| PubChem CID | 155802527 |
| Molecular Formula | C12H23O3- |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 8-hydroxydodecanoate |
| SMILES | CCCCC(O)CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C12H24O3/c1-2-3-8-11(13)9-6-4-5-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/p-1 |
| InChIKey | PPHSOXADSWJILD-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxydodecanoate?
The IUPAC name of 8-hydroxydodecanoate (CID 155802527) is 8-hydroxydodecanoate.
What is the SMILES notation for 8-hydroxydodecanoate?
The canonical SMILES for 8-hydroxydodecanoate is CCCCC(O)CCCCCCC(=O)[O-].
What is the InChIKey of 8-hydroxydodecanoate?
The InChIKey is PPHSOXADSWJILD-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O3/c1-2-3-8-11(13)9-6-4-5-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/p-1.
What are the key properties of 8-hydroxydodecanoate?
8-hydroxydodecanoate has a molecular weight of 215.31 g/mol, XLogP of 1.63, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxydodecanoate is sourced from PubChem (CID 155802527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).