C18H35O4- — CID 25201168
(9S,10S)-9,10-dihydroxyoctadecanoate (PubChem CID 25201168) has the molecular formula C18H35O4- and a molecular weight of 315.47 g/mol. Its IUPAC name is (9S,10S)-9,10-dihydroxyoctadecanoate.
| Compound Name | (9S,10S)-9,10-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 25201168 |
| Molecular Formula | C18H35O4- |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | (9S,10S)-9,10-dihydroxyoctadecanoate |
| SMILES | CCCCCCCC[C@H](O)[C@@H](O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H36O4/c1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22/h16-17,19-20H,2-15H2,1H3,(H,21,22)/p-1/t16-,17-/m0/s1 |
| InChIKey | VACHUYIREGFMSP-IRXDYDNUSA-M |
| XLogP | 2.94 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|