About potassium heptadecanoate
potassium heptadecanoate (PubChem CID 23668524) has the molecular formula C17H33KO2
and a molecular weight of 308.55 g/mol. Its IUPAC name is potassium heptadecanoate.
Molecular Properties
| Compound Name | potassium heptadecanoate |
| PubChem CID | 23668524 |
| Molecular Formula | C17H33KO2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | potassium heptadecanoate |
| SMILES | CCCCCCCCCCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C17H34O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h2-16H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | PLNPAJUNRPFSDU-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium heptadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium heptadecanoate?
The IUPAC name of potassium heptadecanoate (CID 23668524) is potassium heptadecanoate.
What is the SMILES notation for potassium heptadecanoate?
The canonical SMILES for potassium heptadecanoate is CCCCCCCCCCCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium heptadecanoate?
The InChIKey is PLNPAJUNRPFSDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H34O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19;/h2-16H2,1H3,(H,18,19);/q;+1/p-1.
What are the key properties of potassium heptadecanoate?
potassium heptadecanoate has a molecular weight of 308.55 g/mol, XLogP of 1.61, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium heptadecanoate is sourced from PubChem (CID 23668524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).