About potassium pentadecanoate
potassium pentadecanoate (PubChem CID 23696764) has the molecular formula C15H29KO2
and a molecular weight of 280.49 g/mol. Its IUPAC name is potassium pentadecanoate.
Molecular Properties
| Compound Name | potassium pentadecanoate |
| PubChem CID | 23696764 |
| Molecular Formula | C15H29KO2 |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | potassium pentadecanoate |
| SMILES | CCCCCCCCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C15H30O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;/h2-14H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | XYLAMPYYOCATEA-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium pentadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium pentadecanoate?
The IUPAC name of potassium pentadecanoate (CID 23696764) is potassium pentadecanoate.
What is the SMILES notation for potassium pentadecanoate?
The canonical SMILES for potassium pentadecanoate is CCCCCCCCCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium pentadecanoate?
The InChIKey is XYLAMPYYOCATEA-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H30O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;/h2-14H2,1H3,(H,16,17);/q;+1/p-1.
What are the key properties of potassium pentadecanoate?
potassium pentadecanoate has a molecular weight of 280.49 g/mol, XLogP of 0.83, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium pentadecanoate is sourced from PubChem (CID 23696764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).