About potassium decanoate
potassium decanoate (PubChem CID 23688501) has the molecular formula C10H19KO2
and a molecular weight of 210.36 g/mol. Its IUPAC name is potassium decanoate.
Molecular Properties
| Compound Name | potassium decanoate |
| PubChem CID | 23688501 |
| Molecular Formula | C10H19KO2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | potassium decanoate |
| SMILES | CCCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C10H20O2.K/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | QDIGBJJRWUZARS-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium decanoate?
The IUPAC name of potassium decanoate (CID 23688501) is potassium decanoate.
What is the SMILES notation for potassium decanoate?
The canonical SMILES for potassium decanoate is CCCCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium decanoate?
The InChIKey is QDIGBJJRWUZARS-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20O2.K/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of potassium decanoate?
potassium decanoate has a molecular weight of 210.36 g/mol, XLogP of -1.12, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium decanoate is sourced from PubChem (CID 23688501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).