About potassium heptanoate
potassium heptanoate (PubChem CID 23681741) has the molecular formula C7H13KO2
and a molecular weight of 168.28 g/mol. Its IUPAC name is potassium heptanoate.
Molecular Properties
| Compound Name | potassium heptanoate |
| PubChem CID | 23681741 |
| Molecular Formula | C7H13KO2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | potassium heptanoate |
| SMILES | CCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C7H14O2.K/c1-2-3-4-5-6-7(8)9;/h2-6H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | YOSXTSJZQNTKKX-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium heptanoate?
The IUPAC name of potassium heptanoate (CID 23681741) is potassium heptanoate.
What is the SMILES notation for potassium heptanoate?
The canonical SMILES for potassium heptanoate is CCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium heptanoate?
The InChIKey is YOSXTSJZQNTKKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O2.K/c1-2-3-4-5-6-7(8)9;/h2-6H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of potassium heptanoate?
potassium heptanoate has a molecular weight of 168.28 g/mol, XLogP of -2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium heptanoate is sourced from PubChem (CID 23681741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).