C11H22O3 — CID 56979503
2,10-dihydroxyundecan-6-one (PubChem CID 56979503) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 2,10-dihydroxyundecan-6-one.
| Compound Name | 2,10-dihydroxyundecan-6-one |
|---|---|
| PubChem CID | 56979503 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2,10-dihydroxyundecan-6-one |
| SMILES | CC(O)CCCC(=O)CCCC(C)O |
| InChI | InChI=1S/C11H22O3/c1-9(12)5-3-7-11(14)8-4-6-10(2)13/h9-10,12-13H,3-8H2,1-2H3 |
| InChIKey | UHLRCHMFJOLUIR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |