C17H24O4 — CID 122659985
(E)-1-(3,5-dihydroxyphenyl)-10-hydroxyundec-1-en-6-one (PubChem CID 122659985) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (E)-1-(3,5-dihydroxyphenyl)-10-hydroxyundec-1-en-6-one.
| Compound Name | (E)-1-(3,5-dihydroxyphenyl)-10-hydroxyundec-1-en-6-one |
|---|---|
| PubChem CID | 122659985 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (E)-1-(3,5-dihydroxyphenyl)-10-hydroxyundec-1-en-6-one |
| SMILES | CC(O)CCCC(=O)CCC/C=C/c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H24O4/c1-13(18)6-5-9-15(19)8-4-2-3-7-14-10-16(20)12-17(21)11-14/h3,7,10-13,18,20-21H,2,4-6,8-9H2,1H3/b7-3+ |
| InChIKey | TVXRLKRGDWQGQV-XVNBXDOJSA-N |
| XLogP | 3.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|