C26H28O2 — CID 70264367
(E)-7-[4-(6-prop-2-enoxynaphthalen-2-yl)phenyl]hept-6-en-2-ol (PubChem CID 70264367) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (E)-7-[4-(6-prop-2-enoxynaphthalen-2-yl)phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[4-(6-prop-2-enoxynaphthalen-2-yl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70264367 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (E)-7-[4-(6-prop-2-enoxynaphthalen-2-yl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc2cc(-c3ccc(/C=C/CCCC(C)O)cc3)ccc2c1 |
| InChI | InChI=1S/C26H28O2/c1-3-17-28-26-16-15-24-18-23(13-14-25(24)19-26)22-11-9-21(10-12-22)8-6-4-5-7-20(2)27/h3,6,8-16,18-20,27H,1,4-5,7,17H2,2H3/b8-6+ |
| InChIKey | HBQYMSUOJYGEIX-SOFGYWHQSA-N |
| XLogP | 6.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|