C27H29NO2 — CID 70263832
(E)-7-[6-[4-(4-prop-2-enoxyphenyl)phenyl]-3-pyridinyl]hept-6-en-2-ol (PubChem CID 70263832) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is (E)-7-[6-[4-(4-prop-2-enoxyphenyl)phenyl]-3-pyridinyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[6-[4-(4-prop-2-enoxyphenyl)phenyl]-3-pyridinyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263832 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (E)-7-[6-[4-(4-prop-2-enoxyphenyl)phenyl]-3-pyridinyl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(/C=C/CCCC(C)O)cn3)cc2)cc1 |
| InChI | InChI=1S/C27H29NO2/c1-3-19-30-26-16-14-24(15-17-26)23-10-12-25(13-11-23)27-18-9-22(20-28-27)8-6-4-5-7-21(2)29/h3,6,8-18,20-21,29H,1,4-5,7,19H2,2H3/b8-6+ |
| InChIKey | ISIFKKKILGLVIE-SOFGYWHQSA-N |
| XLogP | 6.54 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|