C27H29NO — CID 70262911
7-[4-[5-(4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol (PubChem CID 70262911) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is 7-[4-[5-(4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol.
| Compound Name | 7-[4-[5-(4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70262911 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 7-[4-[5-(4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(C=CCCCC(C)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C27H29NO/c1-3-7-22-10-14-24(15-11-22)26-18-19-27(28-20-26)25-16-12-23(13-17-25)9-6-4-5-8-21(2)29/h3,6,9-21,29H,1,4-5,7-8H2,2H3 |
| InChIKey | DYSGOBDIYMPJHB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|