C27H27F2NO — CID 70263841
(E)-7-[4-[5-(2,3-difluoro-4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol (PubChem CID 70263841) has the molecular formula C27H27F2NO and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-7-[4-[5-(2,3-difluoro-4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[4-[5-(2,3-difluoro-4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263841 |
| Molecular Formula | C27H27F2NO |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (E)-7-[4-[5-(2,3-difluoro-4-prop-2-enylphenyl)-2-pyridinyl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(/C=C/CCCC(C)O)cc3)nc2)c(F)c1F |
| InChI | InChI=1S/C27H27F2NO/c1-3-7-22-14-16-24(27(29)26(22)28)23-15-17-25(30-18-23)21-12-10-20(11-13-21)9-6-4-5-8-19(2)31/h3,6,9-19,31H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | CDNKNZXQXHBJEK-RMKNXTFCSA-N |
| XLogP | 6.99 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|