C24H23F2NO2 — CID 54157007
2,3-difluoro-4-[6-[4-(6-hydroxyhept-1-enyl)phenyl]-3-pyridinyl]phenol (PubChem CID 54157007) has the molecular formula C24H23F2NO2 and a molecular weight of 395.45 g/mol. Its IUPAC name is 2,3-difluoro-4-[6-[4-(6-hydroxyhept-1-enyl)phenyl]-3-pyridinyl]phenol.
| Compound Name | 2,3-difluoro-4-[6-[4-(6-hydroxyhept-1-enyl)phenyl]-3-pyridinyl]phenol |
|---|---|
| PubChem CID | 54157007 |
| Molecular Formula | C24H23F2NO2 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2,3-difluoro-4-[6-[4-(6-hydroxyhept-1-enyl)phenyl]-3-pyridinyl]phenol |
| SMILES | CC(O)CCCC=Cc1ccc(-c2ccc(-c3ccc(O)c(F)c3F)cn2)cc1 |
| InChI | InChI=1S/C24H23F2NO2/c1-16(28)5-3-2-4-6-17-7-9-18(10-8-17)21-13-11-19(15-27-21)20-12-14-22(29)24(26)23(20)25/h4,6-16,28-29H,2-3,5H2,1H3 |
| InChIKey | OLTZZFZIEDQOLJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|