C21H25NO — CID 70264345
(E)-7-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol (PubChem CID 70264345) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (E)-7-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70264345 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (E)-7-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ccc(/C=C/CCCC(C)O)cc2)nc1 |
| InChI | InChI=1S/C21H25NO/c1-3-7-19-12-15-21(22-16-19)20-13-10-18(11-14-20)9-6-4-5-8-17(2)23/h3,6,9-17,23H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | QSIVHIIJBQGHGU-RMKNXTFCSA-N |
| XLogP | 5.04 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|