C21H24FNO — CID 70264311
(E)-7-[3-fluoro-4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol (PubChem CID 70264311) has the molecular formula C21H24FNO and a molecular weight of 325.43 g/mol. Its IUPAC name is (E)-7-[3-fluoro-4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[3-fluoro-4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70264311 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (E)-7-[3-fluoro-4-(5-prop-2-enyl-2-pyridinyl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ccc(/C=C/CCCC(C)O)cc2F)nc1 |
| InChI | InChI=1S/C21H24FNO/c1-3-7-18-11-13-21(23-15-18)19-12-10-17(14-20(19)22)9-6-4-5-8-16(2)24/h3,6,9-16,24H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | KJMZAZQCQOVQHX-RMKNXTFCSA-N |
| XLogP | 5.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|