C27H28FNO — CID 70262711
7-[2-fluoro-4-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]phenyl]hept-6-en-2-ol (PubChem CID 70262711) has the molecular formula C27H28FNO and a molecular weight of 401.53 g/mol. Its IUPAC name is 7-[2-fluoro-4-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]phenyl]hept-6-en-2-ol.
| Compound Name | 7-[2-fluoro-4-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70262711 |
| Molecular Formula | C27H28FNO |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 7-[2-fluoro-4-[4-(5-prop-2-enyl-2-pyridinyl)phenyl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(C=CCCCC(C)O)c(F)c3)cc2)nc1 |
| InChI | InChI=1S/C27H28FNO/c1-3-7-21-10-17-27(29-19-21)24-14-11-22(12-15-24)25-16-13-23(26(28)18-25)9-6-4-5-8-20(2)30/h3,6,9-20,30H,1,4-5,7-8H2,2H3 |
| InChIKey | IWQDQKBIAZGWKS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|