C27H28FNO2 — CID 70261199
7-[4-[6-(2-fluoro-4-prop-2-enoxyphenyl)-3-pyridinyl]phenyl]hept-6-en-2-ol (PubChem CID 70261199) has the molecular formula C27H28FNO2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 7-[4-[6-(2-fluoro-4-prop-2-enoxyphenyl)-3-pyridinyl]phenyl]hept-6-en-2-ol.
| Compound Name | 7-[4-[6-(2-fluoro-4-prop-2-enoxyphenyl)-3-pyridinyl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70261199 |
| Molecular Formula | C27H28FNO2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 7-[4-[6-(2-fluoro-4-prop-2-enoxyphenyl)-3-pyridinyl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C=CCCCC(C)O)cc3)cn2)c(F)c1 |
| InChI | InChI=1S/C27H28FNO2/c1-3-17-31-24-14-15-25(26(28)18-24)27-16-13-23(19-29-27)22-11-9-21(10-12-22)8-6-4-5-7-20(2)30/h3,6,8-16,18-20,30H,1,4-5,7,17H2,2H3 |
| InChIKey | LRJONRQFSNUJSP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|