C26H27FN2O2 — CID 70263223
7-[3-fluoro-4-[4-(5-prop-2-enoxypyrimidin-2-yl)phenyl]phenyl]hept-6-en-2-ol (PubChem CID 70263223) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 7-[3-fluoro-4-[4-(5-prop-2-enoxypyrimidin-2-yl)phenyl]phenyl]hept-6-en-2-ol.
| Compound Name | 7-[3-fluoro-4-[4-(5-prop-2-enoxypyrimidin-2-yl)phenyl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263223 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 7-[3-fluoro-4-[4-(5-prop-2-enoxypyrimidin-2-yl)phenyl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCOc1cnc(-c2ccc(-c3ccc(C=CCCCC(C)O)cc3F)cc2)nc1 |
| InChI | InChI=1S/C26H27FN2O2/c1-3-15-31-23-17-28-26(29-18-23)22-12-10-21(11-13-22)24-14-9-20(16-25(24)27)8-6-4-5-7-19(2)30/h3,6,8-14,16-19,30H,1,4-5,7,15H2,2H3 |
| InChIKey | AIWZAVMJQIULPA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|