C31H37FN2O2 — CID 70265189
5-[2-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-(4-prop-2-enoxyphenyl)pyrimidine (PubChem CID 70265189) has the molecular formula C31H37FN2O2 and a molecular weight of 488.65 g/mol. Its IUPAC name is 5-[2-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-(4-prop-2-enoxyphenyl)pyrimidine.
| Compound Name | 5-[2-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-(4-prop-2-enoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 70265189 |
| Molecular Formula | C31H37FN2O2 |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 5-[2-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-(4-prop-2-enoxyphenyl)pyrimidine |
| SMILES | C=CCOc1ccc(-c2ncc(-c3ccc(C=CCCCC(C)OCCCCC)cc3F)cn2)cc1 |
| InChI | InChI=1S/C31H37FN2O2/c1-4-6-10-20-35-24(3)11-8-7-9-12-25-13-18-29(30(32)21-25)27-22-33-31(34-23-27)26-14-16-28(17-15-26)36-19-5-2/h5,9,12-18,21-24H,2,4,6-8,10-11,19-20H2,1,3H3 |
| InChIKey | CLBMAVPDBRFSDN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|