C33H40O2 — CID 70263182
1-(6-pentoxyhept-1-enyl)-4-[4-(4-prop-2-enoxyphenyl)phenyl]benzene (PubChem CID 70263182) has the molecular formula C33H40O2 and a molecular weight of 468.68 g/mol. Its IUPAC name is 1-(6-pentoxyhept-1-enyl)-4-[4-(4-prop-2-enoxyphenyl)phenyl]benzene.
| Compound Name | 1-(6-pentoxyhept-1-enyl)-4-[4-(4-prop-2-enoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 70263182 |
| Molecular Formula | C33H40O2 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1-(6-pentoxyhept-1-enyl)-4-[4-(4-prop-2-enoxyphenyl)phenyl]benzene |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C=CCCCC(C)OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H40O2/c1-4-6-10-26-34-27(3)11-8-7-9-12-28-13-15-29(16-14-28)30-17-19-31(20-18-30)32-21-23-33(24-22-32)35-25-5-2/h5,9,12-24,27H,2,4,6-8,10-11,25-26H2,1,3H3 |
| InChIKey | AOHXPLDVOWHSTE-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|