C26H35NO2 — CID 70264274
2-(6-pentoxyhept-1-enyl)-5-(4-prop-2-enoxyphenyl)pyridine (PubChem CID 70264274) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 2-(6-pentoxyhept-1-enyl)-5-(4-prop-2-enoxyphenyl)pyridine.
| Compound Name | 2-(6-pentoxyhept-1-enyl)-5-(4-prop-2-enoxyphenyl)pyridine |
|---|---|
| PubChem CID | 70264274 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-(6-pentoxyhept-1-enyl)-5-(4-prop-2-enoxyphenyl)pyridine |
| SMILES | C=CCOc1ccc(-c2ccc(C=CCCCC(C)OCCCCC)nc2)cc1 |
| InChI | InChI=1S/C26H35NO2/c1-4-6-10-20-28-22(3)11-8-7-9-12-25-16-13-24(21-27-25)23-14-17-26(18-15-23)29-19-5-2/h5,9,12-18,21-22H,2,4,6-8,10-11,19-20H2,1,3H3 |
| InChIKey | NJRNWSOIYWXVND-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|