C32H38FNO2 — CID 70260675
5-[4-[3-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]-2-prop-2-enoxypyridine (PubChem CID 70260675) has the molecular formula C32H38FNO2 and a molecular weight of 487.66 g/mol. Its IUPAC name is 5-[4-[3-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]-2-prop-2-enoxypyridine.
| Compound Name | 5-[4-[3-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]-2-prop-2-enoxypyridine |
|---|---|
| PubChem CID | 70260675 |
| Molecular Formula | C32H38FNO2 |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 5-[4-[3-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]-2-prop-2-enoxypyridine |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(/C=C/CCCC(C)OCCCCC)c(F)c3)cc2)cn1 |
| InChI | InChI=1S/C32H38FNO2/c1-4-6-10-22-35-25(3)11-8-7-9-12-28-17-18-29(23-31(28)33)26-13-15-27(16-14-26)30-19-20-32(34-24-30)36-21-5-2/h5,9,12-20,23-25H,2,4,6-8,10-11,21-22H2,1,3H3/b12-9+ |
| InChIKey | QOVSTUNVMXIDBQ-FMIVXFBMSA-N |
| XLogP | 8.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|