C29H35FN2O — CID 70265419
6-[3-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-prop-2-enylquinoxaline (PubChem CID 70265419) has the molecular formula C29H35FN2O and a molecular weight of 446.61 g/mol. Its IUPAC name is 6-[3-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-prop-2-enylquinoxaline.
| Compound Name | 6-[3-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-prop-2-enylquinoxaline |
|---|---|
| PubChem CID | 70265419 |
| Molecular Formula | C29H35FN2O |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 6-[3-fluoro-4-(6-pentoxyhept-1-enyl)phenyl]-2-prop-2-enylquinoxaline |
| SMILES | C=CCc1cnc2cc(-c3ccc(C=CCCCC(C)OCCCCC)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C29H35FN2O/c1-4-6-10-18-33-22(3)12-8-7-9-13-23-14-15-24(19-27(23)30)25-16-17-28-29(20-25)31-21-26(32-28)11-5-2/h5,9,13-17,19-22H,2,4,6-8,10-12,18H2,1,3H3 |
| InChIKey | DCZPMIMGSDFBNY-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|