C24H24F2N2O — CID 70263046
7-[2,3-difluoro-4-(2-prop-2-enylquinoxalin-6-yl)phenyl]hept-6-en-2-ol (PubChem CID 70263046) has the molecular formula C24H24F2N2O and a molecular weight of 394.47 g/mol. Its IUPAC name is 7-[2,3-difluoro-4-(2-prop-2-enylquinoxalin-6-yl)phenyl]hept-6-en-2-ol.
| Compound Name | 7-[2,3-difluoro-4-(2-prop-2-enylquinoxalin-6-yl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263046 |
| Molecular Formula | C24H24F2N2O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 7-[2,3-difluoro-4-(2-prop-2-enylquinoxalin-6-yl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1cnc2cc(-c3ccc(C=CCCCC(C)O)c(F)c3F)ccc2n1 |
| InChI | InChI=1S/C24H24F2N2O/c1-3-7-19-15-27-22-14-18(11-13-21(22)28-19)20-12-10-17(23(25)24(20)26)9-6-4-5-8-16(2)29/h3,6,9-16,29H,1,4-5,7-8H2,2H3 |
| InChIKey | AOSITLHPQKQGPG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|