C24H24F2N2O2 — CID 70260867
7-[6-(2,3-difluoro-4-prop-2-enoxyphenyl)quinazolin-2-yl]hept-6-en-2-ol (PubChem CID 70260867) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is 7-[6-(2,3-difluoro-4-prop-2-enoxyphenyl)quinazolin-2-yl]hept-6-en-2-ol.
| Compound Name | 7-[6-(2,3-difluoro-4-prop-2-enoxyphenyl)quinazolin-2-yl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70260867 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 7-[6-(2,3-difluoro-4-prop-2-enoxyphenyl)quinazolin-2-yl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc(-c2ccc3nc(C=CCCCC(C)O)ncc3c2)c(F)c1F |
| InChI | InChI=1S/C24H24F2N2O2/c1-3-13-30-21-12-10-19(23(25)24(21)26)17-9-11-20-18(14-17)15-27-22(28-20)8-6-4-5-7-16(2)29/h3,6,8-12,14-16,29H,1,4-5,7,13H2,2H3 |
| InChIKey | PMNFFKAUTNAQEK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|