C21H23F2NO2 — CID 70264361
7-[2,3-difluoro-4-(5-prop-2-enoxy-2-pyridinyl)phenyl]hept-6-en-2-ol (PubChem CID 70264361) has the molecular formula C21H23F2NO2 and a molecular weight of 359.42 g/mol. Its IUPAC name is 7-[2,3-difluoro-4-(5-prop-2-enoxy-2-pyridinyl)phenyl]hept-6-en-2-ol.
| Compound Name | 7-[2,3-difluoro-4-(5-prop-2-enoxy-2-pyridinyl)phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70264361 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 7-[2,3-difluoro-4-(5-prop-2-enoxy-2-pyridinyl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc(-c2ccc(C=CCCCC(C)O)c(F)c2F)nc1 |
| InChI | InChI=1S/C21H23F2NO2/c1-3-13-26-17-10-12-19(24-14-17)18-11-9-16(20(22)21(18)23)8-6-4-5-7-15(2)25/h3,6,8-12,14-15,25H,1,4-5,7,13H2,2H3 |
| InChIKey | QDOUFLPFUSEBLY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|