C17H18F2N2O2 — CID 19352710
2-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-ol (PubChem CID 19352710) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-ol.
| Compound Name | 2-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-ol |
|---|---|
| PubChem CID | 19352710 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-ol |
| SMILES | CC(O)CCC/C=C/c1ccc(-c2ncc(O)cn2)c(F)c1F |
| InChI | InChI=1S/C17H18F2N2O2/c1-11(22)5-3-2-4-6-12-7-8-14(16(19)15(12)18)17-20-9-13(23)10-21-17/h4,6-11,22-23H,2-3,5H2,1H3/b6-4+ |
| InChIKey | KLQZCTOGUSVAMU-GQCTYLIASA-N |
| XLogP | 3.69 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|