C25H24F2O2 — CID 22354182
4-[4-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]phenyl]phenol (PubChem CID 22354182) has the molecular formula C25H24F2O2 and a molecular weight of 394.46 g/mol. Its IUPAC name is 4-[4-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]phenyl]phenol.
| Compound Name | 4-[4-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 22354182 |
| Molecular Formula | C25H24F2O2 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[4-[2,3-difluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]phenyl]phenol |
| SMILES | CC(O)CCC/C=C/c1ccc(-c2ccc(-c3ccc(O)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C25H24F2O2/c1-17(28)5-3-2-4-6-21-13-16-23(25(27)24(21)26)20-9-7-18(8-10-20)19-11-14-22(29)15-12-19/h4,6-17,28-29H,2-3,5H2,1H3/b6-4+ |
| InChIKey | XJTLRSDXWKLXMG-GQCTYLIASA-N |
| XLogP | 6.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|