C23H23FN2O2 — CID 19352655
4-[2-[3-fluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-yl]phenol (PubChem CID 19352655) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-yl]phenol.
| Compound Name | 4-[2-[3-fluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-yl]phenol |
|---|---|
| PubChem CID | 19352655 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[2-[3-fluoro-4-[(E)-6-hydroxyhept-1-enyl]phenyl]pyrimidin-5-yl]phenol |
| SMILES | CC(O)CCC/C=C/c1ccc(-c2ncc(-c3ccc(O)cc3)cn2)cc1F |
| InChI | InChI=1S/C23H23FN2O2/c1-16(27)5-3-2-4-6-18-7-8-19(13-22(18)24)23-25-14-20(15-26-23)17-9-11-21(28)12-10-17/h4,6-16,27-28H,2-3,5H2,1H3/b6-4+ |
| InChIKey | XFDVYQOAJRCFMJ-GQCTYLIASA-N |
| XLogP | 5.22 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|