C26H27FN2O — CID 70263409
(E)-7-[3-fluoro-4-[2-(4-prop-2-enylphenyl)pyrimidin-5-yl]phenyl]hept-6-en-2-ol (PubChem CID 70263409) has the molecular formula C26H27FN2O and a molecular weight of 402.51 g/mol. Its IUPAC name is (E)-7-[3-fluoro-4-[2-(4-prop-2-enylphenyl)pyrimidin-5-yl]phenyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[3-fluoro-4-[2-(4-prop-2-enylphenyl)pyrimidin-5-yl]phenyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263409 |
| Molecular Formula | C26H27FN2O |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (E)-7-[3-fluoro-4-[2-(4-prop-2-enylphenyl)pyrimidin-5-yl]phenyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2ncc(-c3ccc(/C=C/CCCC(C)O)cc3F)cn2)cc1 |
| InChI | InChI=1S/C26H27FN2O/c1-3-7-20-10-13-22(14-11-20)26-28-17-23(18-29-26)24-15-12-21(16-25(24)27)9-6-4-5-8-19(2)30/h3,6,9-19,30H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | NFOJJQIKIFYHFW-RMKNXTFCSA-N |
| XLogP | 6.24 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|