C18H19F2NO2 — CID 19352550
2,3-difluoro-4-[6-[(E)-6-hydroxyhept-1-enyl]-3-pyridinyl]phenol (PubChem CID 19352550) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 2,3-difluoro-4-[6-[(E)-6-hydroxyhept-1-enyl]-3-pyridinyl]phenol.
| Compound Name | 2,3-difluoro-4-[6-[(E)-6-hydroxyhept-1-enyl]-3-pyridinyl]phenol |
|---|---|
| PubChem CID | 19352550 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2,3-difluoro-4-[6-[(E)-6-hydroxyhept-1-enyl]-3-pyridinyl]phenol |
| SMILES | CC(O)CCC/C=C/c1ccc(-c2ccc(O)c(F)c2F)cn1 |
| InChI | InChI=1S/C18H19F2NO2/c1-12(22)5-3-2-4-6-14-8-7-13(11-21-14)15-9-10-16(23)18(20)17(15)19/h4,6-12,22-23H,2-3,5H2,1H3/b6-4+ |
| InChIKey | VLBPNAKWCIPZJG-GQCTYLIASA-N |
| XLogP | 4.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|