C28H32F2N2O2 — CID 70263779
2,3-difluoro-4-[4-[2-[(E)-6-pentoxyhept-1-enyl]pyrimidin-5-yl]phenyl]phenol (PubChem CID 70263779) has the molecular formula C28H32F2N2O2 and a molecular weight of 466.57 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[2-[(E)-6-pentoxyhept-1-enyl]pyrimidin-5-yl]phenyl]phenol.
| Compound Name | 2,3-difluoro-4-[4-[2-[(E)-6-pentoxyhept-1-enyl]pyrimidin-5-yl]phenyl]phenol |
|---|---|
| PubChem CID | 70263779 |
| Molecular Formula | C28H32F2N2O2 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2,3-difluoro-4-[4-[2-[(E)-6-pentoxyhept-1-enyl]pyrimidin-5-yl]phenyl]phenol |
| SMILES | CCCCCOC(C)CCC/C=C/c1ncc(-c2ccc(-c3ccc(O)c(F)c3F)cc2)cn1 |
| InChI | InChI=1S/C28H32F2N2O2/c1-3-4-8-17-34-20(2)9-6-5-7-10-26-31-18-23(19-32-26)21-11-13-22(14-12-21)24-15-16-25(33)28(30)27(24)29/h7,10-16,18-20,33H,3-6,8-9,17H2,1-2H3/b10-7+ |
| InChIKey | OOFATMLWHHFFKM-JXMROGBWSA-N |
| XLogP | 7.57 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|