C31H38N2O — CID 70264469
2-[(E)-6-pentoxyhept-1-enyl]-5-[4-(4-prop-2-enylphenyl)phenyl]pyrimidine (PubChem CID 70264469) has the molecular formula C31H38N2O and a molecular weight of 454.66 g/mol. Its IUPAC name is 2-[(E)-6-pentoxyhept-1-enyl]-5-[4-(4-prop-2-enylphenyl)phenyl]pyrimidine.
| Compound Name | 2-[(E)-6-pentoxyhept-1-enyl]-5-[4-(4-prop-2-enylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 70264469 |
| Molecular Formula | C31H38N2O |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 2-[(E)-6-pentoxyhept-1-enyl]-5-[4-(4-prop-2-enylphenyl)phenyl]pyrimidine |
| SMILES | C=CCc1ccc(-c2ccc(-c3cnc(/C=C/CCCC(C)OCCCCC)nc3)cc2)cc1 |
| InChI | InChI=1S/C31H38N2O/c1-4-6-10-22-34-25(3)12-8-7-9-13-31-32-23-30(24-33-31)29-20-18-28(19-21-29)27-16-14-26(11-5-2)15-17-27/h5,9,13-21,23-25H,2,4,6-8,10-12,22H2,1,3H3/b13-9+ |
| InChIKey | WYFGXTBJRHTEMK-UKTHLTGXSA-N |
| XLogP | 8.32 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|