C25H33FN2O2 — CID 70263525
5-(3-fluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine (PubChem CID 70263525) has the molecular formula C25H33FN2O2 and a molecular weight of 412.55 g/mol. Its IUPAC name is 5-(3-fluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine.
| Compound Name | 5-(3-fluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine |
|---|---|
| PubChem CID | 70263525 |
| Molecular Formula | C25H33FN2O2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 5-(3-fluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine |
| SMILES | C=CCOc1ccc(-c2cnc(C=CCCCC(C)OCCCCC)nc2)cc1F |
| InChI | InChI=1S/C25H33FN2O2/c1-4-6-10-16-29-20(3)11-8-7-9-12-25-27-18-22(19-28-25)21-13-14-24(23(26)17-21)30-15-5-2/h5,9,12-14,17-20H,2,4,6-8,10-11,15-16H2,1,3H3 |
| InChIKey | LKKGZZJZJUNOBR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|